C22H32O4Si — CID 135026288
ethyl (2E,4E,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-oxo-7-phenylhepta-2,4-dienoate (PubChem CID 135026288) has the molecular formula C22H32O4Si and a molecular weight of 388.58 g/mol. Its IUPAC name is ethyl (2E,4E,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-oxo-7-phenylhepta-2,4-dienoate.
| Compound Name | ethyl (2E,4E,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-oxo-7-phenylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 135026288 |
| Molecular Formula | C22H32O4Si |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | ethyl (2E,4E,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-oxo-7-phenylhepta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C/C=C/C(=O)[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H32O4Si/c1-8-25-21(24)17(2)13-12-16-19(23)20(18-14-10-9-11-15-18)26-27(6,7)22(3,4)5/h9-16,20H,8H2,1-7H3/b16-12+,17-13+/t20-/m1/s1 |
| InChIKey | CFYOVCKQNXZTNN-CEBOVBPNSA-N |
| XLogP | 5.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|