C35H38O2P+ — CID 88805250
[(2E,4E,6E,8E,10Z)-12-ethoxy-3,7,11-trimethyl-12-oxododeca-2,4,6,8,10-pentaenyl]-triphenylphosphanium (PubChem CID 88805250) has the molecular formula C35H38O2P+ and a molecular weight of 521.66 g/mol. Its IUPAC name is [(2E,4E,6E,8E,10Z)-12-ethoxy-3,7,11-trimethyl-12-oxododeca-2,4,6,8,10-pentaenyl]-triphenylphosphanium.
| Compound Name | [(2E,4E,6E,8E,10Z)-12-ethoxy-3,7,11-trimethyl-12-oxododeca-2,4,6,8,10-pentaenyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 88805250 |
| Molecular Formula | C35H38O2P+ |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | [(2E,4E,6E,8E,10Z)-12-ethoxy-3,7,11-trimethyl-12-oxododeca-2,4,6,8,10-pentaenyl]-triphenylphosphanium |
| SMILES | CCOC(=O)/C(C)=C\C=C\C(C)=C\C=C\C(C)=C\C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H38O2P/c1-5-37-35(36)31(4)20-16-19-29(2)17-15-18-30(3)27-28-38(32-21-9-6-10-22-32,33-23-11-7-12-24-33)34-25-13-8-14-26-34/h6-27H,5,28H2,1-4H3/q+1/b18-15+,19-16+,29-17+,30-27+,31-20- |
| InChIKey | XBYFRJFIHMMZMB-FIODAXQGSA-N |
| XLogP | 7.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|