C38H40P+ — CID 88803855
[3,7-dimethyl-9-(2,3,4-trimethylphenyl)nona-2,4,6,8-tetraenyl]-triphenylphosphanium (PubChem CID 88803855) has the molecular formula C38H40P+ and a molecular weight of 527.71 g/mol. Its IUPAC name is [3,7-dimethyl-9-(2,3,4-trimethylphenyl)nona-2,4,6,8-tetraenyl]-triphenylphosphanium.
| Compound Name | [3,7-dimethyl-9-(2,3,4-trimethylphenyl)nona-2,4,6,8-tetraenyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 88803855 |
| Molecular Formula | C38H40P+ |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | [3,7-dimethyl-9-(2,3,4-trimethylphenyl)nona-2,4,6,8-tetraenyl]-triphenylphosphanium |
| SMILES | CC(C=Cc1ccc(C)c(C)c1C)=CC=CC(C)=CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H40P/c1-30(24-26-35-27-25-32(3)33(4)34(35)5)16-15-17-31(2)28-29-39(36-18-9-6-10-19-36,37-20-11-7-12-21-37)38-22-13-8-14-23-38/h6-28H,29H2,1-5H3/q+1 |
| InChIKey | CORHWHUEGVZCAI-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|