C39H46BrOP — CID 160915974
[(2E)-3-methyl-5-(2-nonoxyphenyl)penta-2,4-dienyl]-triphenylphosphanium bromide (PubChem CID 160915974) has the molecular formula C39H46BrOP and a molecular weight of 641.67 g/mol. Its IUPAC name is [(2E)-3-methyl-5-(2-nonoxyphenyl)penta-2,4-dienyl]-triphenylphosphanium bromide.
| Compound Name | [(2E)-3-methyl-5-(2-nonoxyphenyl)penta-2,4-dienyl]-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 160915974 |
| Molecular Formula | C39H46BrOP |
| Molecular Weight | 641.67 g/mol |
| Exact Mass | 640.25 |
| IUPAC Name | [(2E)-3-methyl-5-(2-nonoxyphenyl)penta-2,4-dienyl]-triphenylphosphanium bromide |
| SMILES | CCCCCCCCCOc1ccccc1C=C/C(C)=C/C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C39H46OP.BrH/c1-3-4-5-6-7-8-20-32-40-39-28-19-18-21-35(39)30-29-34(2)31-33-41(36-22-12-9-13-23-36,37-24-14-10-15-25-37)38-26-16-11-17-27-38;/h9-19,21-31H,3-8,20,32-33H2,1-2H3;1H/q+1;/p-1/b30-29?,34-31+; |
| InChIKey | SRKFQPJPOPJPPQ-FOSODYRZSA-M |
| XLogP | 6.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.67 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|