C28H30P+ — CID 135021083
[(4E)-3,7-dimethylocta-2,4,6-trienyl]-triphenylphosphanium (PubChem CID 135021083) has the molecular formula C28H30P+ and a molecular weight of 397.52 g/mol. Its IUPAC name is [(4E)-3,7-dimethylocta-2,4,6-trienyl]-triphenylphosphanium.
| Compound Name | [(4E)-3,7-dimethylocta-2,4,6-trienyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 135021083 |
| Molecular Formula | C28H30P+ |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | [(4E)-3,7-dimethylocta-2,4,6-trienyl]-triphenylphosphanium |
| SMILES | CC(C)=C/C=C/C(C)=CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H30P/c1-24(2)14-13-15-25(3)22-23-29(26-16-7-4-8-17-26,27-18-9-5-10-19-27)28-20-11-6-12-21-28/h4-22H,23H2,1-3H3/q+1/b15-13+,25-22? |
| InChIKey | GPTJLPNUUHQKFZ-MFKCPUGGSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|