C33H39N3O2P+ — CID 174368548
[5-[4-hydroxy-2,6,6-tris(methylamino)-3-oxocyclohexen-1-yl]-3-methylpenta-2,4-dienyl]-triphenylphosphanium (PubChem CID 174368548) has the molecular formula C33H39N3O2P+ and a molecular weight of 540.67 g/mol. Its IUPAC name is [5-[4-hydroxy-2,6,6-tris(methylamino)-3-oxocyclohexen-1-yl]-3-methylpenta-2,4-dienyl]-triphenylphosphanium.
| Compound Name | [5-[4-hydroxy-2,6,6-tris(methylamino)-3-oxocyclohexen-1-yl]-3-methylpenta-2,4-dienyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 174368548 |
| Molecular Formula | C33H39N3O2P+ |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | [5-[4-hydroxy-2,6,6-tris(methylamino)-3-oxocyclohexen-1-yl]-3-methylpenta-2,4-dienyl]-triphenylphosphanium |
| SMILES | CNC1=C(C=CC(C)=CC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C(NC)(NC)CC(O)C1=O |
| InChI | InChI=1S/C33H39N3O2P/c1-25(20-21-29-31(34-2)32(38)30(37)24-33(29,35-3)36-4)22-23-39(26-14-8-5-9-15-26,27-16-10-6-11-17-27)28-18-12-7-13-19-28/h5-22,30,34-37H,23-24H2,1-4H3/q+1 |
| InChIKey | GTABVKVCSIUGDW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|