C33H38BrP — CID 10995183
triphenyl-[(2E,4E,6Z)-3,7,11-trimethyldodeca-2,4,6,10-tetraenyl]phosphanium bromide (PubChem CID 10995183) has the molecular formula C33H38BrP and a molecular weight of 545.55 g/mol. Its IUPAC name is triphenyl-[(2E,4E,6Z)-3,7,11-trimethyldodeca-2,4,6,10-tetraenyl]phosphanium bromide.
| Compound Name | triphenyl-[(2E,4E,6Z)-3,7,11-trimethyldodeca-2,4,6,10-tetraenyl]phosphanium bromide |
|---|---|
| PubChem CID | 10995183 |
| Molecular Formula | C33H38BrP |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | triphenyl-[(2E,4E,6Z)-3,7,11-trimethyldodeca-2,4,6,10-tetraenyl]phosphanium bromide |
| SMILES | CC(C)=CCC/C(C)=C\C=C\C(C)=C\C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C33H38P.BrH/c1-28(2)16-14-17-29(3)18-15-19-30(4)26-27-34(31-20-8-5-9-21-31,32-22-10-6-11-23-32)33-24-12-7-13-25-33;/h5-13,15-16,18-26H,14,17,27H2,1-4H3;1H/q+1;/p-1/b19-15+,29-18-,30-26+; |
| InChIKey | ANFNYUHNBSZFKE-USKPKCGZSA-M |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|