C34H42ClP — CID 158884671
triphenyl(3,7,11-trimethyltrideca-2,6,10-trienyl)phosphanium chloride (PubChem CID 158884671) has the molecular formula C34H42ClP and a molecular weight of 517.14 g/mol. Its IUPAC name is triphenyl(3,7,11-trimethyltrideca-2,6,10-trienyl)phosphanium chloride.
| Compound Name | triphenyl(3,7,11-trimethyltrideca-2,6,10-trienyl)phosphanium chloride |
|---|---|
| PubChem CID | 158884671 |
| Molecular Formula | C34H42ClP |
| Molecular Weight | 517.14 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | triphenyl(3,7,11-trimethyltrideca-2,6,10-trienyl)phosphanium chloride |
| SMILES | CCC(C)=CCCC(C)=CCCC(C)=CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C34H42P.ClH/c1-5-29(2)17-15-18-30(3)19-16-20-31(4)27-28-35(32-21-9-6-10-22-32,33-23-11-7-12-24-33)34-25-13-8-14-26-34;/h6-14,17,19,21-27H,5,15-16,18,20,28H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | JDLXAWCVGLCGMP-UHFFFAOYSA-M |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.14 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|