C26H28ClO2P — CID 87981709
[(Z)-3-methyl-4-oxo-4-propan-2-yloxybut-2-enyl]-triphenylphosphanium chloride (PubChem CID 87981709) has the molecular formula C26H28ClO2P and a molecular weight of 438.94 g/mol. Its IUPAC name is [(Z)-3-methyl-4-oxo-4-propan-2-yloxybut-2-enyl]-triphenylphosphanium chloride.
| Compound Name | [(Z)-3-methyl-4-oxo-4-propan-2-yloxybut-2-enyl]-triphenylphosphanium chloride |
|---|---|
| PubChem CID | 87981709 |
| Molecular Formula | C26H28ClO2P |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | [(Z)-3-methyl-4-oxo-4-propan-2-yloxybut-2-enyl]-triphenylphosphanium chloride |
| SMILES | C/C(=C/C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC(C)C.[Cl-] |
| InChI | InChI=1S/C26H28O2P.ClH/c1-21(2)28-26(27)22(3)19-20-29(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25;/h4-19,21H,20H2,1-3H3;1H/q+1;/p-1/b22-19-; |
| InChIKey | GKGYOZSPDFTWPP-GXTSIBQPSA-M |
| XLogP | 1.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|