C29H32O2P+ — CID 57349793
(8-methoxy-3,7-dimethyl-8-oxoocta-2,6-dienyl)-triphenylphosphanium (PubChem CID 57349793) has the molecular formula C29H32O2P+ and a molecular weight of 443.55 g/mol. Its IUPAC name is (8-methoxy-3,7-dimethyl-8-oxoocta-2,6-dienyl)-triphenylphosphanium.
| Compound Name | (8-methoxy-3,7-dimethyl-8-oxoocta-2,6-dienyl)-triphenylphosphanium |
|---|---|
| PubChem CID | 57349793 |
| Molecular Formula | C29H32O2P+ |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (8-methoxy-3,7-dimethyl-8-oxoocta-2,6-dienyl)-triphenylphosphanium |
| SMILES | COC(=O)C(C)=CCCC(C)=CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H32O2P/c1-24(14-13-15-25(2)29(30)31-3)22-23-32(26-16-7-4-8-17-26,27-18-9-5-10-19-27)28-20-11-6-12-21-28/h4-12,15-22H,13-14,23H2,1-3H3/q+1 |
| InChIKey | FCEADKPNCCVDTC-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|