C33H38P+ — CID 85236634
[3-methyl-5-(2,3,3-trimethylcyclohexen-1-yl)penta-2,4-dienyl]-triphenylphosphanium (PubChem CID 85236634) has the molecular formula C33H38P+ and a molecular weight of 465.64 g/mol. Its IUPAC name is [3-methyl-5-(2,3,3-trimethylcyclohexen-1-yl)penta-2,4-dienyl]-triphenylphosphanium.
| Compound Name | [3-methyl-5-(2,3,3-trimethylcyclohexen-1-yl)penta-2,4-dienyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 85236634 |
| Molecular Formula | C33H38P+ |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | [3-methyl-5-(2,3,3-trimethylcyclohexen-1-yl)penta-2,4-dienyl]-triphenylphosphanium |
| SMILES | CC(C=CC1=C(C)C(C)(C)CCC1)=CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H38P/c1-27(22-23-29-15-14-25-33(3,4)28(29)2)24-26-34(30-16-8-5-9-17-30,31-18-10-6-11-19-31)32-20-12-7-13-21-32/h5-13,16-24H,14-15,25-26H2,1-4H3/q+1 |
| InChIKey | SGBWSWFIZYBAAX-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|