C26H26O2Sn — CID 177386904
ethyl (2E,4Z)-2-methyl-5-triphenylstannylpenta-2,4-dienoate (PubChem CID 177386904) has the molecular formula C26H26O2Sn and a molecular weight of 489.20 g/mol. Its IUPAC name is ethyl (2E,4Z)-2-methyl-5-triphenylstannylpenta-2,4-dienoate.
| Compound Name | ethyl (2E,4Z)-2-methyl-5-triphenylstannylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 177386904 |
| Molecular Formula | C26H26O2Sn |
| Molecular Weight | 489.20 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | ethyl (2E,4Z)-2-methyl-5-triphenylstannylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C/C=C\[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C8H11O2.3C6H5.Sn/c1-4-6-7(3)8(9)10-5-2;3*1-2-4-6-5-3-1;/h1,4,6H,5H2,2-3H3;3*1-5H;/b4-1?,7-6+;;;; |
| InChIKey | SVOACEJFUXGSIR-LDCWWTEVSA-N |
| XLogP | 3.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|