C12H20O2 — CID 88840952
ethyl (2E,4E)-2,7-dimethylocta-2,4-dienoate (PubChem CID 88840952) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is ethyl (2E,4E)-2,7-dimethylocta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-2,7-dimethylocta-2,4-dienoate |
|---|---|
| PubChem CID | 88840952 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | ethyl (2E,4E)-2,7-dimethylocta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C/C=C/CC(C)C |
| InChI | InChI=1S/C12H20O2/c1-5-14-12(13)11(4)9-7-6-8-10(2)3/h6-7,9-10H,5,8H2,1-4H3/b7-6+,11-9+ |
| InChIKey | ROAUHFZVSJOYJD-RXUIJTJXSA-N |
| XLogP | 3.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|