C10H12F4O2 — CID 15215965
ethyl (2E,4E)-6,6,7,7-tetrafluoro-2-methylhepta-2,4-dienoate (PubChem CID 15215965) has the molecular formula C10H12F4O2 and a molecular weight of 240.20 g/mol. Its IUPAC name is ethyl (2E,4E)-6,6,7,7-tetrafluoro-2-methylhepta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-6,6,7,7-tetrafluoro-2-methylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 15215965 |
| Molecular Formula | C10H12F4O2 |
| Molecular Weight | 240.20 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | ethyl (2E,4E)-6,6,7,7-tetrafluoro-2-methylhepta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C/C=C/C(F)(F)C(F)F |
| InChI | InChI=1S/C10H12F4O2/c1-3-16-8(15)7(2)5-4-6-10(13,14)9(11)12/h4-6,9H,3H2,1-2H3/b6-4+,7-5+ |
| InChIKey | VCDLPUJYJLNDPI-YDFGWWAZSA-N |
| XLogP | 2.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.20 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|