C10H12O2 — CID 11816044
ethyl (2E,4E)-2-methylhepta-2,4-dien-6-ynoate (PubChem CID 11816044) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is ethyl (2E,4E)-2-methylhepta-2,4-dien-6-ynoate.
| Compound Name | ethyl (2E,4E)-2-methylhepta-2,4-dien-6-ynoate |
|---|---|
| PubChem CID | 11816044 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | ethyl (2E,4E)-2-methylhepta-2,4-dien-6-ynoate |
| SMILES | C#C/C=C/C=C(\C)C(=O)OCC |
| InChI | InChI=1S/C10H12O2/c1-4-6-7-8-9(3)10(11)12-5-2/h1,6-8H,5H2,2-3H3/b7-6+,9-8+ |
| InChIKey | NTRXYXMASHRCCP-BLHCBFLLSA-N |
| XLogP | 1.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|