C24H32O4 — CID 158426875
carbon dioxide;ethyl (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-tetramethylheptadeca-2,4,6,8,10,12,14-heptaenoate (PubChem CID 158426875) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is carbon dioxide;ethyl (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-tetramethylheptadeca-2,4,6,8,10,12,14-heptaenoate.
| Compound Name | carbon dioxide;ethyl (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-tetramethylheptadeca-2,4,6,8,10,12,14-heptaenoate |
|---|---|
| PubChem CID | 158426875 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | carbon dioxide;ethyl (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-tetramethylheptadeca-2,4,6,8,10,12,14-heptaenoate |
| SMILES | CCOC(=O)/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(\C)CC.O=C=O |
| InChI | InChI=1S/C23H32O2.CO2/c1-7-19(3)15-11-16-20(4)13-9-10-14-21(5)17-12-18-22(6)23(24)25-8-2;2-1-3/h9-18H,7-8H2,1-6H3;/b10-9+,16-11+,17-12+,19-15+,20-13+,21-14+,22-18+; |
| InChIKey | HBDSXJRUDMAXNR-TZLUUCIZSA-N |
| XLogP | 5.83 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|