C28H36O4 — CID 123615733
diethyl 2,6,11,17-tetramethylicosa-2,4,6,8,10,12,14,16,18-nonaenedioate (PubChem CID 123615733) has the molecular formula C28H36O4 and a molecular weight of 436.59 g/mol. Its IUPAC name is diethyl 2,6,11,17-tetramethylicosa-2,4,6,8,10,12,14,16,18-nonaenedioate.
| Compound Name | diethyl 2,6,11,17-tetramethylicosa-2,4,6,8,10,12,14,16,18-nonaenedioate |
|---|---|
| PubChem CID | 123615733 |
| Molecular Formula | C28H36O4 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | diethyl 2,6,11,17-tetramethylicosa-2,4,6,8,10,12,14,16,18-nonaenedioate |
| SMILES | CCOC(=O)C=CC(C)=CC=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C(=O)OCC |
| InChI | InChI=1S/C28H36O4/c1-7-31-27(29)22-21-25(5)16-11-9-10-15-23(3)17-12-13-18-24(4)19-14-20-26(6)28(30)32-8-2/h9-22H,7-8H2,1-6H3 |
| InChIKey | OJFYXOAYBODZOS-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|