C22H30O4 — CID 11717423
diethyl (2E,4E,6E,8E,10E,12E)-2,4,9,13-tetramethyltetradeca-2,4,6,8,10,12-hexaenedioate (PubChem CID 11717423) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is diethyl (2E,4E,6E,8E,10E,12E)-2,4,9,13-tetramethyltetradeca-2,4,6,8,10,12-hexaenedioate.
| Compound Name | diethyl (2E,4E,6E,8E,10E,12E)-2,4,9,13-tetramethyltetradeca-2,4,6,8,10,12-hexaenedioate |
|---|---|
| PubChem CID | 11717423 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | diethyl (2E,4E,6E,8E,10E,12E)-2,4,9,13-tetramethyltetradeca-2,4,6,8,10,12-hexaenedioate |
| SMILES | CCOC(=O)/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C(\C)C(=O)OCC |
| InChI | InChI=1S/C22H30O4/c1-7-25-21(23)19(5)15-11-14-17(3)12-9-10-13-18(4)16-20(6)22(24)26-8-2/h9-16H,7-8H2,1-6H3/b10-9+,14-11+,17-12+,18-13+,19-15+,20-16+ |
| InChIKey | MDOZVRAIXNFIQJ-AEBTUUNHSA-N |
| XLogP | 5.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|