C32H35NO3Si — CID 11341192
N-[(1S)-3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1-phenylpropyl]benzamide (PubChem CID 11341192) has the molecular formula C32H35NO3Si and a molecular weight of 509.72 g/mol. Its IUPAC name is N-[(1S)-3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1-phenylpropyl]benzamide.
| Compound Name | N-[(1S)-3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 11341192 |
| Molecular Formula | C32H35NO3Si |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | N-[(1S)-3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1-phenylpropyl]benzamide |
| SMILES | CC(C)(C)[Si](OCC(O)[C@@H](NC(=O)c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H35NO3Si/c1-32(2,3)37(27-20-12-6-13-21-27,28-22-14-7-15-23-28)36-24-29(34)30(25-16-8-4-9-17-25)33-31(35)26-18-10-5-11-19-26/h4-23,29-30,34H,24H2,1-3H3,(H,33,35)/t29?,30-/m0/s1 |
| InChIKey | SOQKVMGIQDXFNI-ZSXSBBPPSA-N |
| XLogP | 5.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|