C28H34ClNO2Si — CID 11134602
N-[1-[tert-butyl(diphenyl)silyl]oxy-3-methylbutan-2-yl]-4-chlorobenzamide (PubChem CID 11134602) has the molecular formula C28H34ClNO2Si and a molecular weight of 480.12 g/mol. Its IUPAC name is N-[1-[tert-butyl(diphenyl)silyl]oxy-3-methylbutan-2-yl]-4-chlorobenzamide.
| Compound Name | N-[1-[tert-butyl(diphenyl)silyl]oxy-3-methylbutan-2-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 11134602 |
| Molecular Formula | C28H34ClNO2Si |
| Molecular Weight | 480.12 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | N-[1-[tert-butyl(diphenyl)silyl]oxy-3-methylbutan-2-yl]-4-chlorobenzamide |
| SMILES | CC(C)C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H34ClNO2Si/c1-21(2)26(30-27(31)22-16-18-23(29)19-17-22)20-32-33(28(3,4)5,24-12-8-6-9-13-24)25-14-10-7-11-15-25/h6-19,21,26H,20H2,1-5H3,(H,30,31) |
| InChIKey | OTCABOBJQJCHGX-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.12 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|