C34H39NO4Si — CID 159958128
benzyl N-[(1R,2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1-(4-methylphenyl)propyl]carbamate (PubChem CID 159958128) has the molecular formula C34H39NO4Si and a molecular weight of 553.78 g/mol. Its IUPAC name is benzyl N-[(1R,2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1-(4-methylphenyl)propyl]carbamate.
| Compound Name | benzyl N-[(1R,2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1-(4-methylphenyl)propyl]carbamate |
|---|---|
| PubChem CID | 159958128 |
| Molecular Formula | C34H39NO4Si |
| Molecular Weight | 553.78 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | benzyl N-[(1R,2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1-(4-methylphenyl)propyl]carbamate |
| SMILES | Cc1ccc([C@@H](NC(=O)OCc2ccccc2)[C@H](O)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C34H39NO4Si/c1-26-20-22-28(23-21-26)32(35-33(37)38-24-27-14-8-5-9-15-27)31(36)25-39-40(34(2,3)4,29-16-10-6-11-17-29)30-18-12-7-13-19-30/h5-23,31-32,36H,24-25H2,1-4H3,(H,35,37)/t31-,32-/m1/s1 |
| InChIKey | LHPJKCUFBVPKEE-ROJLCIKYSA-N |
| XLogP | 5.90 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.78 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|