C32H36O6Si — CID 11656802
benzyl 5-[(1S,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1,2-dihydroxypropyl]-2-methylfuran-3-carboxylate (PubChem CID 11656802) has the molecular formula C32H36O6Si and a molecular weight of 544.72 g/mol. Its IUPAC name is benzyl 5-[(1S,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1,2-dihydroxypropyl]-2-methylfuran-3-carboxylate.
| Compound Name | benzyl 5-[(1S,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1,2-dihydroxypropyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 11656802 |
| Molecular Formula | C32H36O6Si |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | benzyl 5-[(1S,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1,2-dihydroxypropyl]-2-methylfuran-3-carboxylate |
| SMILES | Cc1oc([C@@H](O)[C@H](O)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H36O6Si/c1-23-27(31(35)36-21-24-14-8-5-9-15-24)20-29(38-23)30(34)28(33)22-37-39(32(2,3)4,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-20,28,30,33-34H,21-22H2,1-4H3/t28-,30+/m1/s1 |
| InChIKey | BQNLBGAPPIEWOF-DGPALRBDSA-N |
| XLogP | 4.92 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|