C33H35NO5SSi — CID 134864194
benzyl 5-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-sulfanylidene-1,3-oxazolidin-4-yl]-2-methylfuran-3-carboxylate (PubChem CID 134864194) has the molecular formula C33H35NO5SSi and a molecular weight of 585.80 g/mol. Its IUPAC name is benzyl 5-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-sulfanylidene-1,3-oxazolidin-4-yl]-2-methylfuran-3-carboxylate.
| Compound Name | benzyl 5-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-sulfanylidene-1,3-oxazolidin-4-yl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 134864194 |
| Molecular Formula | C33H35NO5SSi |
| Molecular Weight | 585.80 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | benzyl 5-[(4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-sulfanylidene-1,3-oxazolidin-4-yl]-2-methylfuran-3-carboxylate |
| SMILES | Cc1oc([C@H]2NC(=S)O[C@@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H35NO5SSi/c1-23-27(31(35)36-21-24-14-8-5-9-15-24)20-28(38-23)30-29(39-32(40)34-30)22-37-41(33(2,3)4,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-20,29-30H,21-22H2,1-4H3,(H,34,40)/t29-,30-/m1/s1 |
| InChIKey | LTUZLJBTEIEGFW-LOYHVIPDSA-N |
| XLogP | 5.84 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.80 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|