C27H35BO5 — CID 166439775
benzyl 5-[(E)-2-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-methylfuran-3-carboxylate (PubChem CID 166439775) has the molecular formula C27H35BO5 and a molecular weight of 450.38 g/mol. Its IUPAC name is benzyl 5-[(E)-2-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-methylfuran-3-carboxylate.
| Compound Name | benzyl 5-[(E)-2-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 166439775 |
| Molecular Formula | C27H35BO5 |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | benzyl 5-[(E)-2-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-methylfuran-3-carboxylate |
| SMILES | Cc1oc(/C(=C/C2CCCCC2)B2OC(C)(C)C(C)(C)O2)cc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H35BO5/c1-19-22(25(29)30-18-21-14-10-7-11-15-21)17-24(31-19)23(16-20-12-8-6-9-13-20)28-32-26(2,3)27(4,5)33-28/h7,10-11,14-17,20H,6,8-9,12-13,18H2,1-5H3/b23-16- |
| InChIKey | YGWQSADTRHLKCS-KQWNVCNZSA-N |
| XLogP | 6.54 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|