C24H27BFNO4 — CID 171110489
benzyl 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,3-dihydroindole-1-carboxylate (PubChem CID 171110489) has the molecular formula C24H27BFNO4 and a molecular weight of 423.29 g/mol. Its IUPAC name is benzyl 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,3-dihydroindole-1-carboxylate.
| Compound Name | benzyl 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 171110489 |
| Molecular Formula | C24H27BFNO4 |
| Molecular Weight | 423.29 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | benzyl 2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,3-dihydroindole-1-carboxylate |
| SMILES | CC1(C)OB(C(F)=CC2Cc3ccccc3N2C(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C24H27BFNO4/c1-23(2)24(3,4)31-25(30-23)21(26)15-19-14-18-12-8-9-13-20(18)27(19)22(28)29-16-17-10-6-5-7-11-17/h5-13,15,19H,14,16H2,1-4H3 |
| InChIKey | OGGSNGLILGEDSA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.29 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|