C21H24N2O3Si — CID 71064221
benzyl 2-[cyano(trimethylsilyloxy)methyl]-2,3-dihydroindole-1-carboxylate (PubChem CID 71064221) has the molecular formula C21H24N2O3Si and a molecular weight of 380.52 g/mol. Its IUPAC name is benzyl 2-[cyano(trimethylsilyloxy)methyl]-2,3-dihydroindole-1-carboxylate.
| Compound Name | benzyl 2-[cyano(trimethylsilyloxy)methyl]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 71064221 |
| Molecular Formula | C21H24N2O3Si |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | benzyl 2-[cyano(trimethylsilyloxy)methyl]-2,3-dihydroindole-1-carboxylate |
| SMILES | C[Si](C)(C)OC(C#N)C1Cc2ccccc2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H24N2O3Si/c1-27(2,3)26-20(14-22)19-13-17-11-7-8-12-18(17)23(19)21(24)25-15-16-9-5-4-6-10-16/h4-12,19-20H,13,15H2,1-3H3 |
| InChIKey | GCRHONZGVZYTJI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|