C30H28N4O4S — CID 143681120
benzyl (2S)-2-[[[4-[4-(cyclopropylcarbamoyl)phenyl]-1,3-thiazol-2-yl]amino]-hydroxymethyl]-2,3-dihydroindole-1-carboxylate (PubChem CID 143681120) has the molecular formula C30H28N4O4S and a molecular weight of 540.65 g/mol. Its IUPAC name is benzyl (2S)-2-[[[4-[4-(cyclopropylcarbamoyl)phenyl]-1,3-thiazol-2-yl]amino]-hydroxymethyl]-2,3-dihydroindole-1-carboxylate.
| Compound Name | benzyl (2S)-2-[[[4-[4-(cyclopropylcarbamoyl)phenyl]-1,3-thiazol-2-yl]amino]-hydroxymethyl]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 143681120 |
| Molecular Formula | C30H28N4O4S |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | benzyl (2S)-2-[[[4-[4-(cyclopropylcarbamoyl)phenyl]-1,3-thiazol-2-yl]amino]-hydroxymethyl]-2,3-dihydroindole-1-carboxylate |
| SMILES | O=C(NC1CC1)c1ccc(-c2csc(NC(O)[C@@H]3Cc4ccccc4N3C(=O)OCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C30H28N4O4S/c35-27(31-23-14-15-23)21-12-10-20(11-13-21)24-18-39-29(32-24)33-28(36)26-16-22-8-4-5-9-25(22)34(26)30(37)38-17-19-6-2-1-3-7-19/h1-13,18,23,26,28,36H,14-17H2,(H,31,35)(H,32,33)/t26-,28?/m0/s1 |
| InChIKey | CGGGZQPNNQIGFE-QODXOHEASA-N |
| XLogP | 5.20 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|