C26H26N4O4S — CID 174574020
benzyl (3R)-3-[[4-[4-(cyclopropylcarbamoyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]-2-iminopentanoate (PubChem CID 174574020) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is benzyl (3R)-3-[[4-[4-(cyclopropylcarbamoyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]-2-iminopentanoate.
| Compound Name | benzyl (3R)-3-[[4-[4-(cyclopropylcarbamoyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]-2-iminopentanoate |
|---|---|
| PubChem CID | 174574020 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | benzyl (3R)-3-[[4-[4-(cyclopropylcarbamoyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]-2-iminopentanoate |
| SMILES | [H]/N=C(\C(=O)OCc1ccccc1)[C@@H](CC)C(=O)Nc1nc(-c2ccc(C(=O)NC3CC3)cc2)cs1 |
| InChI | InChI=1S/C26H26N4O4S/c1-2-20(22(27)25(33)34-14-16-6-4-3-5-7-16)24(32)30-26-29-21(15-35-26)17-8-10-18(11-9-17)23(31)28-19-12-13-19/h3-11,15,19-20,27H,2,12-14H2,1H3,(H,28,31)(H,29,30,32)/b27-22-/t20-/m1/s1 |
| InChIKey | BXOBNOIGVNJNAE-OLUGBCFNSA-N |
| XLogP | 4.43 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|