C22H22N4O3S — CID 174559342
benzyl (3S)-3-[[4-(4-aminophenyl)-1,3-thiazol-2-yl]carbamoyl]-2-iminopentanoate (PubChem CID 174559342) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is benzyl (3S)-3-[[4-(4-aminophenyl)-1,3-thiazol-2-yl]carbamoyl]-2-iminopentanoate.
| Compound Name | benzyl (3S)-3-[[4-(4-aminophenyl)-1,3-thiazol-2-yl]carbamoyl]-2-iminopentanoate |
|---|---|
| PubChem CID | 174559342 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | benzyl (3S)-3-[[4-(4-aminophenyl)-1,3-thiazol-2-yl]carbamoyl]-2-iminopentanoate |
| SMILES | [H]/N=C(\C(=O)OCc1ccccc1)[C@H](CC)C(=O)Nc1nc(-c2ccc(N)cc2)cs1 |
| InChI | InChI=1S/C22H22N4O3S/c1-2-17(19(24)21(28)29-12-14-6-4-3-5-7-14)20(27)26-22-25-18(13-30-22)15-8-10-16(23)11-9-15/h3-11,13,17,24H,2,12,23H2,1H3,(H,25,26,27)/b24-19-/t17-/m0/s1 |
| InChIKey | OCXBBMNTFBRIFZ-AOVJEQHFSA-N |
| XLogP | 4.12 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|