C25H27N3O4S — CID 174574026
benzyl 2-imino-3-[[5-(4-propoxyphenyl)-1,3-thiazol-2-yl]carbamoyl]pentanoate (PubChem CID 174574026) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is benzyl 2-imino-3-[[5-(4-propoxyphenyl)-1,3-thiazol-2-yl]carbamoyl]pentanoate.
| Compound Name | benzyl 2-imino-3-[[5-(4-propoxyphenyl)-1,3-thiazol-2-yl]carbamoyl]pentanoate |
|---|---|
| PubChem CID | 174574026 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | benzyl 2-imino-3-[[5-(4-propoxyphenyl)-1,3-thiazol-2-yl]carbamoyl]pentanoate |
| SMILES | [H]/N=C(\C(=O)OCc1ccccc1)C(CC)C(=O)Nc1ncc(-c2ccc(OCCC)cc2)s1 |
| InChI | InChI=1S/C25H27N3O4S/c1-3-14-31-19-12-10-18(11-13-19)21-15-27-25(33-21)28-23(29)20(4-2)22(26)24(30)32-16-17-8-6-5-7-9-17/h5-13,15,20,26H,3-4,14,16H2,1-2H3,(H,27,28,29)/b26-22- |
| InChIKey | LFXARLSRFKXTRK-ROMGYVFFSA-N |
| XLogP | 5.33 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|