C23H21N3O5S — CID 174574062
3-[2-[[(2S)-2-ethyl-3-imino-4-oxo-4-phenylmethoxybutanoyl]amino]-1,3-thiazol-5-yl]benzoic acid (PubChem CID 174574062) has the molecular formula C23H21N3O5S and a molecular weight of 451.50 g/mol. Its IUPAC name is 3-[2-[[(2S)-2-ethyl-3-imino-4-oxo-4-phenylmethoxybutanoyl]amino]-1,3-thiazol-5-yl]benzoic acid.
| Compound Name | 3-[2-[[(2S)-2-ethyl-3-imino-4-oxo-4-phenylmethoxybutanoyl]amino]-1,3-thiazol-5-yl]benzoic acid |
|---|---|
| PubChem CID | 174574062 |
| Molecular Formula | C23H21N3O5S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 3-[2-[[(2S)-2-ethyl-3-imino-4-oxo-4-phenylmethoxybutanoyl]amino]-1,3-thiazol-5-yl]benzoic acid |
| SMILES | [H]/N=C(\C(=O)OCc1ccccc1)[C@H](CC)C(=O)Nc1ncc(-c2cccc(C(=O)O)c2)s1 |
| InChI | InChI=1S/C23H21N3O5S/c1-2-17(19(24)22(30)31-13-14-7-4-3-5-8-14)20(27)26-23-25-12-18(32-23)15-9-6-10-16(11-15)21(28)29/h3-12,17,24H,2,13H2,1H3,(H,28,29)(H,25,26,27)/b24-19-/t17-/m0/s1 |
| InChIKey | AMZGWBIDDQPTNL-AOVJEQHFSA-N |
| XLogP | 4.24 |
| TPSA | 129.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|