C23H28N4O4S — CID 174574120
tert-butyl (3S)-3-[[4-[4-(cyclopropylcarbamoyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]-2-iminopentanoate (PubChem CID 174574120) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[4-[4-(cyclopropylcarbamoyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]-2-iminopentanoate.
| Compound Name | tert-butyl (3S)-3-[[4-[4-(cyclopropylcarbamoyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]-2-iminopentanoate |
|---|---|
| PubChem CID | 174574120 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | tert-butyl (3S)-3-[[4-[4-(cyclopropylcarbamoyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]-2-iminopentanoate |
| SMILES | [H]/N=C(\C(=O)OC(C)(C)C)[C@H](CC)C(=O)Nc1nc(-c2ccc(C(=O)NC3CC3)cc2)cs1 |
| InChI | InChI=1S/C23H28N4O4S/c1-5-16(18(24)21(30)31-23(2,3)4)20(29)27-22-26-17(12-32-22)13-6-8-14(9-7-13)19(28)25-15-10-11-15/h6-9,12,15-16,24H,5,10-11H2,1-4H3,(H,25,28)(H,26,27,29)/b24-18-/t16-/m0/s1 |
| InChIKey | KIFIHTFPHSPURZ-YKTMHCBJSA-N |
| XLogP | 4.03 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|