C24H20F3N3O2 — CID 164935328
benzyl 2-[3-phenyl-3-(trifluoromethyl)diaziridin-1-yl]-2,3-dihydroindole-1-carboxylate (PubChem CID 164935328) has the molecular formula C24H20F3N3O2 and a molecular weight of 439.44 g/mol. Its IUPAC name is benzyl 2-[3-phenyl-3-(trifluoromethyl)diaziridin-1-yl]-2,3-dihydroindole-1-carboxylate.
| Compound Name | benzyl 2-[3-phenyl-3-(trifluoromethyl)diaziridin-1-yl]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 164935328 |
| Molecular Formula | C24H20F3N3O2 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | benzyl 2-[3-phenyl-3-(trifluoromethyl)diaziridin-1-yl]-2,3-dihydroindole-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1c2ccccc2CC1N1NC1(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H20F3N3O2/c25-24(26,27)23(19-12-5-2-6-13-19)28-30(23)21-15-18-11-7-8-14-20(18)29(21)22(31)32-16-17-9-3-1-4-10-17/h1-14,21,28H,15-16H2 |
| InChIKey | MBFXYYNLIDBPBD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 54.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|