C18H16F3NO2 — CID 141123853
benzyl 2-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 141123853) has the molecular formula C18H16F3NO2 and a molecular weight of 335.33 g/mol. Its IUPAC name is benzyl 2-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | benzyl 2-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 141123853 |
| Molecular Formula | C18H16F3NO2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | benzyl 2-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1c2ccccc2CCC1C(F)(F)F |
| InChI | InChI=1S/C18H16F3NO2/c19-18(20,21)16-11-10-14-8-4-5-9-15(14)22(16)17(23)24-12-13-6-2-1-3-7-13/h1-9,16H,10-12H2 |
| InChIKey | WAGPOLCCGUQNTR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |