C15H16F3NO2 — CID 11438008
benzyl 2-(trifluoromethyl)-2,3,6,7-tetrahydroazepine-1-carboxylate (PubChem CID 11438008) has the molecular formula C15H16F3NO2 and a molecular weight of 299.29 g/mol. Its IUPAC name is benzyl 2-(trifluoromethyl)-2,3,6,7-tetrahydroazepine-1-carboxylate.
| Compound Name | benzyl 2-(trifluoromethyl)-2,3,6,7-tetrahydroazepine-1-carboxylate |
|---|---|
| PubChem CID | 11438008 |
| Molecular Formula | C15H16F3NO2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | benzyl 2-(trifluoromethyl)-2,3,6,7-tetrahydroazepine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC=CCC1C(F)(F)F |
| InChI | InChI=1S/C15H16F3NO2/c16-15(17,18)13-9-5-2-6-10-19(13)14(20)21-11-12-7-3-1-4-8-12/h1-5,7-8,13H,6,9-11H2 |
| InChIKey | MHPMFXVYUCNOMK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|