C17H18F3NO4 — CID 135012695
benzyl (3R)-10-oxo-3-(trifluoromethyl)-3,5,8,9-tetrahydro-2H-1,4-oxazecine-4-carboxylate (PubChem CID 135012695) has the molecular formula C17H18F3NO4 and a molecular weight of 357.33 g/mol. Its IUPAC name is benzyl (3R)-10-oxo-3-(trifluoromethyl)-3,5,8,9-tetrahydro-2H-1,4-oxazecine-4-carboxylate.
| Compound Name | benzyl (3R)-10-oxo-3-(trifluoromethyl)-3,5,8,9-tetrahydro-2H-1,4-oxazecine-4-carboxylate |
|---|---|
| PubChem CID | 135012695 |
| Molecular Formula | C17H18F3NO4 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | benzyl (3R)-10-oxo-3-(trifluoromethyl)-3,5,8,9-tetrahydro-2H-1,4-oxazecine-4-carboxylate |
| SMILES | O=C1CCC=CCN(C(=O)OCc2ccccc2)[C@@H](C(F)(F)F)CO1 |
| InChI | InChI=1S/C17H18F3NO4/c18-17(19,20)14-12-24-15(22)9-5-2-6-10-21(14)16(23)25-11-13-7-3-1-4-8-13/h1-4,6-8,14H,5,9-12H2/t14-/m1/s1 |
| InChIKey | JODOVRHRTZAUCZ-CQSZACIVSA-N |
| XLogP | 3.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|