C16H18N2O4 — CID 102407150
benzyl (3Z,6aR)-9-oxo-5,6,6a,7-tetrahydro-2H-[1,3]oxazolo[3,4-b]diazocine-1-carboxylate (PubChem CID 102407150) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is benzyl (3Z,6aR)-9-oxo-5,6,6a,7-tetrahydro-2H-[1,3]oxazolo[3,4-b]diazocine-1-carboxylate.
| Compound Name | benzyl (3Z,6aR)-9-oxo-5,6,6a,7-tetrahydro-2H-[1,3]oxazolo[3,4-b]diazocine-1-carboxylate |
|---|---|
| PubChem CID | 102407150 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | benzyl (3Z,6aR)-9-oxo-5,6,6a,7-tetrahydro-2H-[1,3]oxazolo[3,4-b]diazocine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C/C=C\CC[C@@H]2COC(=O)N21 |
| InChI | InChI=1S/C16H18N2O4/c19-15(21-11-13-7-3-1-4-8-13)17-10-6-2-5-9-14-12-22-16(20)18(14)17/h1-4,6-8,14H,5,9-12H2/b6-2-/t14-/m1/s1 |
| InChIKey | SPGBYGIUUBQSRE-OKEUPSHZSA-N |
| XLogP | 2.71 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|