C18H24N2O4 — CID 11370987
1-O-benzyl 2-O-tert-butyl 4,7-dihydro-3H-diazepine-1,2-dicarboxylate (PubChem CID 11370987) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 1-O-benzyl 2-O-tert-butyl 4,7-dihydro-3H-diazepine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-tert-butyl 4,7-dihydro-3H-diazepine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11370987 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-O-benzyl 2-O-tert-butyl 4,7-dihydro-3H-diazepine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC=CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H24N2O4/c1-18(2,3)24-17(22)20-13-9-5-8-12-19(20)16(21)23-14-15-10-6-4-7-11-15/h4-8,10-11H,9,12-14H2,1-3H3 |
| InChIKey | QITXFOFCEVJVDI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|