C17H27NO2 — CID 143937845
benzyl 3,6-dihydro-2H-pyridine-1-carboxylate;ethane (PubChem CID 143937845) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is benzyl 3,6-dihydro-2H-pyridine-1-carboxylate;ethane.
| Compound Name | benzyl 3,6-dihydro-2H-pyridine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 143937845 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | benzyl 3,6-dihydro-2H-pyridine-1-carboxylate;ethane |
| SMILES | CC.CC.O=C(OCc1ccccc1)N1CC=CCC1 |
| InChI | InChI=1S/C13H15NO2.2C2H6/c15-13(14-9-5-2-6-10-14)16-11-12-7-3-1-4-8-12;2*1-2/h1-5,7-8H,6,9-11H2;2*1-2H3 |
| InChIKey | JKNBSNDAZWVPPA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|