C32H46N2O4 — CID 158077262
benzyl N,N-bis(but-3-enyl)carbamate;benzyl 2,3,6,7-tetrahydroazepine-1-carboxylate;methane (PubChem CID 158077262) has the molecular formula C32H46N2O4 and a molecular weight of 522.73 g/mol. Its IUPAC name is benzyl N,N-bis(but-3-enyl)carbamate;benzyl 2,3,6,7-tetrahydroazepine-1-carboxylate;methane.
| Compound Name | benzyl N,N-bis(but-3-enyl)carbamate;benzyl 2,3,6,7-tetrahydroazepine-1-carboxylate;methane |
|---|---|
| PubChem CID | 158077262 |
| Molecular Formula | C32H46N2O4 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | benzyl N,N-bis(but-3-enyl)carbamate;benzyl 2,3,6,7-tetrahydroazepine-1-carboxylate;methane |
| SMILES | C.C.C=CCCN(CCC=C)C(=O)OCc1ccccc1.O=C(OCc1ccccc1)N1CCC=CCC1 |
| InChI | InChI=1S/C16H21NO2.C14H17NO2.2CH4/c1-3-5-12-17(13-6-4-2)16(18)19-14-15-10-8-7-9-11-15;16-14(15-10-6-1-2-7-11-15)17-12-13-8-4-3-5-9-13;;/h3-4,7-11H,1-2,5-6,12-14H2;1-5,8-9H,6-7,10-12H2;2*1H4 |
| InChIKey | FMNGQSZCSCLMNQ-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|