C29H37BO4 — CID 135062354
methyl 4-[(Z)-1-cyclohexyl-3-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]benzoate (PubChem CID 135062354) has the molecular formula C29H37BO4 and a molecular weight of 460.42 g/mol. Its IUPAC name is methyl 4-[(Z)-1-cyclohexyl-3-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]benzoate.
| Compound Name | methyl 4-[(Z)-1-cyclohexyl-3-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]benzoate |
|---|---|
| PubChem CID | 135062354 |
| Molecular Formula | C29H37BO4 |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | methyl 4-[(Z)-1-cyclohexyl-3-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(/C(Cc2ccccc2)=C(/B2OC(C)(C)C(C)(C)O2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C29H37BO4/c1-28(2)29(3,4)34-30(33-28)26(23-14-10-7-11-15-23)25(20-21-12-8-6-9-13-21)22-16-18-24(19-17-22)27(31)32-5/h6,8-9,12-13,16-19,23H,7,10-11,14-15,20H2,1-5H3/b26-25+ |
| InChIKey | IVXRVOZWQQIDFN-OCEACIFDSA-N |
| XLogP | 6.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|