C47H70O7Si2 — CID 101094072
[(2R,3R,4R,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxy-6-(cyclohexylmethoxy)-5-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 101094072) has the molecular formula C47H70O7Si2 and a molecular weight of 803.24 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxy-6-(cyclohexylmethoxy)-5-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4R,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxy-6-(cyclohexylmethoxy)-5-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101094072 |
| Molecular Formula | C47H70O7Si2 |
| Molecular Weight | 803.24 g/mol |
| Exact Mass | 802.47 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxy-6-(cyclohexylmethoxy)-5-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@@H](OCC2CCCCC2)[C@@H](OCc2ccccc2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C47H70O7Si2/c1-45(2,3)44(48)51-34-39-40(54-56(47(7,8)9,37-28-20-14-21-29-37)38-30-22-15-23-31-38)41(53-55(10,11)46(4,5)6)42(49-32-35-24-16-12-17-25-35)43(52-39)50-33-36-26-18-13-19-27-36/h12,14-17,20-25,28-31,36,39-43H,13,18-19,26-27,32-34H2,1-11H3/t39-,40-,41+,42+,43-/m1/s1 |
| InChIKey | LKWNDBGKZIBCMC-UMCCLHMTSA-N |
| XLogP | 9.82 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.24 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|