C20H31NO4 — CID 101351639
tert-butyl (2S)-2-benzamido-3-hydroxynonanoate (PubChem CID 101351639) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is tert-butyl (2S)-2-benzamido-3-hydroxynonanoate.
| Compound Name | tert-butyl (2S)-2-benzamido-3-hydroxynonanoate |
|---|---|
| PubChem CID | 101351639 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | tert-butyl (2S)-2-benzamido-3-hydroxynonanoate |
| SMILES | CCCCCCC(O)[C@H](NC(=O)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H31NO4/c1-5-6-7-11-14-16(22)17(19(24)25-20(2,3)4)21-18(23)15-12-9-8-10-13-15/h8-10,12-13,16-17,22H,5-7,11,14H2,1-4H3,(H,21,23)/t16?,17-/m0/s1 |
| InChIKey | WSQPSTMRVFOEHB-DJNXLDHESA-N |
| XLogP | 3.46 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|