C22H27NO5 — CID 11361143
methyl (2S,3R)-2-benzamido-3-hydroxy-7-phenylmethoxyheptanoate (PubChem CID 11361143) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is methyl (2S,3R)-2-benzamido-3-hydroxy-7-phenylmethoxyheptanoate.
| Compound Name | methyl (2S,3R)-2-benzamido-3-hydroxy-7-phenylmethoxyheptanoate |
|---|---|
| PubChem CID | 11361143 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | methyl (2S,3R)-2-benzamido-3-hydroxy-7-phenylmethoxyheptanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1ccccc1)[C@H](O)CCCCOCc1ccccc1 |
| InChI | InChI=1S/C22H27NO5/c1-27-22(26)20(23-21(25)18-12-6-3-7-13-18)19(24)14-8-9-15-28-16-17-10-4-2-5-11-17/h2-7,10-13,19-20,24H,8-9,14-16H2,1H3,(H,23,25)/t19-,20+/m1/s1 |
| InChIKey | UCMJMZZUMYYVTK-UXHICEINSA-N |
| XLogP | 2.71 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|