C24H26OSi — CID 11233667
trimethyl-[(Z)-1,1,3-triphenylprop-2-enoxy]silane (PubChem CID 11233667) has the molecular formula C24H26OSi and a molecular weight of 358.56 g/mol. Its IUPAC name is trimethyl-[(Z)-1,1,3-triphenylprop-2-enoxy]silane.
| Compound Name | trimethyl-[(Z)-1,1,3-triphenylprop-2-enoxy]silane |
|---|---|
| PubChem CID | 11233667 |
| Molecular Formula | C24H26OSi |
| Molecular Weight | 358.56 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | trimethyl-[(Z)-1,1,3-triphenylprop-2-enoxy]silane |
| SMILES | C[Si](C)(C)OC(/C=C\c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26OSi/c1-26(2,3)25-24(22-15-9-5-10-16-22,23-17-11-6-12-18-23)20-19-21-13-7-4-8-14-21/h4-20H,1-3H3/b20-19- |
| InChIKey | WOGSEIVEMRMEED-VXPUYCOJSA-N |
| XLogP | 6.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|