C17H19O2P — CID 13196807
(E)-1-dimethylphosphoryl-1,3-diphenylprop-2-en-1-ol (PubChem CID 13196807) has the molecular formula C17H19O2P and a molecular weight of 286.31 g/mol. Its IUPAC name is (E)-1-dimethylphosphoryl-1,3-diphenylprop-2-en-1-ol.
| Compound Name | (E)-1-dimethylphosphoryl-1,3-diphenylprop-2-en-1-ol |
|---|---|
| PubChem CID | 13196807 |
| Molecular Formula | C17H19O2P |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (E)-1-dimethylphosphoryl-1,3-diphenylprop-2-en-1-ol |
| SMILES | CP(C)(=O)C(O)(/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19O2P/c1-20(2,19)17(18,16-11-7-4-8-12-16)14-13-15-9-5-3-6-10-15/h3-14,18H,1-2H3/b14-13+ |
| InChIKey | CLQBXWNVQQVORJ-BUHFOSPRSA-N |
| XLogP | 4.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|