C12H15BrO2 — CID 170561254
(E)-5-bromo-1-phenylhex-1-ene-3,3-diol (PubChem CID 170561254) has the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. Its IUPAC name is (E)-5-bromo-1-phenylhex-1-ene-3,3-diol.
| Compound Name | (E)-5-bromo-1-phenylhex-1-ene-3,3-diol |
|---|---|
| PubChem CID | 170561254 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | (E)-5-bromo-1-phenylhex-1-ene-3,3-diol |
| SMILES | CC(Br)CC(O)(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H15BrO2/c1-10(13)9-12(14,15)8-7-11-5-3-2-4-6-11/h2-8,10,14-15H,9H2,1H3/b8-7+ |
| InChIKey | DFCADAMICWEUSR-BQYQJAHWSA-N |
| XLogP | 2.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|