C10H9F3O2 — CID 89384206
(E)-1,1,1-trifluoro-4-phenylbut-3-ene-2,2-diol (PubChem CID 89384206) has the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-4-phenylbut-3-ene-2,2-diol.
| Compound Name | (E)-1,1,1-trifluoro-4-phenylbut-3-ene-2,2-diol |
|---|---|
| PubChem CID | 89384206 |
| Molecular Formula | C10H9F3O2 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | (E)-1,1,1-trifluoro-4-phenylbut-3-ene-2,2-diol |
| SMILES | OC(O)(/C=C/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H9F3O2/c11-10(12,13)9(14,15)7-6-8-4-2-1-3-5-8/h1-7,14-15H/b7-6+ |
| InChIKey | ZEGKHDRULCVRNH-VOTSOKGWSA-N |
| XLogP | 1.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|