C18H32O2Si2 — CID 12066571
trimethyl-[(2R,3S)-3-phenyl-2-trimethylsilyloxyhex-5-en-3-yl]oxysilane (PubChem CID 12066571) has the molecular formula C18H32O2Si2 and a molecular weight of 336.62 g/mol. Its IUPAC name is trimethyl-[(2R,3S)-3-phenyl-2-trimethylsilyloxyhex-5-en-3-yl]oxysilane.
| Compound Name | trimethyl-[(2R,3S)-3-phenyl-2-trimethylsilyloxyhex-5-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 12066571 |
| Molecular Formula | C18H32O2Si2 |
| Molecular Weight | 336.62 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | trimethyl-[(2R,3S)-3-phenyl-2-trimethylsilyloxyhex-5-en-3-yl]oxysilane |
| SMILES | C=CC[C@](O[Si](C)(C)C)(c1ccccc1)[C@@H](C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H32O2Si2/c1-9-15-18(20-22(6,7)8,16(2)19-21(3,4)5)17-13-11-10-12-14-17/h9-14,16H,1,15H2,2-8H3/t16-,18-/m1/s1 |
| InChIKey | VZCCRWUWPSUGND-SJLPKXTDSA-N |
| XLogP | 5.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|