C19H24O2 — CID 101079968
[(3S,4R)-3,4-bis(prop-2-enoxy)hepta-1,6-dien-4-yl]benzene (PubChem CID 101079968) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is [(3S,4R)-3,4-bis(prop-2-enoxy)hepta-1,6-dien-4-yl]benzene.
| Compound Name | [(3S,4R)-3,4-bis(prop-2-enoxy)hepta-1,6-dien-4-yl]benzene |
|---|---|
| PubChem CID | 101079968 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | [(3S,4R)-3,4-bis(prop-2-enoxy)hepta-1,6-dien-4-yl]benzene |
| SMILES | C=CCO[C@@H](C=C)[C@](CC=C)(OCC=C)c1ccccc1 |
| InChI | InChI=1S/C19H24O2/c1-5-14-19(21-16-7-3,17-12-10-9-11-13-17)18(8-4)20-15-6-2/h5-13,18H,1-4,14-16H2/t18-,19+/m0/s1 |
| InChIKey | KIJXRTHVMAOVIX-RBUKOAKNSA-N |
| XLogP | 4.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|